C26H40N4O4 — CID 172912125
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]ethanone;formic acid (PubChem CID 172912125) has the molecular formula C26H40N4O4 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]ethanone;formic acid.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]ethanone;formic acid |
|---|---|
| PubChem CID | 172912125 |
| Molecular Formula | C26H40N4O4 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.30 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrrolidin-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]ethanone;formic acid |
| SMILES | Cc1cccc(N2CCN(CC(=O)N3C[C@H]4C[C@@H](N5CCCC5)[C@H](O)C[C@H]4C3)CC2)c1.O=CO |
| InChI | InChI=1S/C25H38N4O2.CH2O2/c1-19-5-4-6-22(13-19)27-11-9-26(10-12-27)18-25(31)29-16-20-14-23(28-7-2-3-8-28)24(30)15-21(20)17-29;2-1-3/h4-6,13,20-21,23-24,30H,2-3,7-12,14-18H2,1H3;1H,(H,2,3)/t20-,21+,23-,24-;/m1./s1 |
| InChIKey | SRPQZIHTRUBIAG-HTBXTVNKSA-N |
| XLogP | 1.51 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|