C19H30Cl2N4O3S — CID 120657575
1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylethanone;dihydrochloride (PubChem CID 120657575) has the molecular formula C19H30Cl2N4O3S and a molecular weight of 465.45 g/mol. Its IUPAC name is 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylethanone;dihydrochloride.
| Compound Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylethanone;dihydrochloride |
|---|---|
| PubChem CID | 120657575 |
| Molecular Formula | C19H30Cl2N4O3S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 1-[(3aR,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylethanone;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)CC(=O)N3C[C@H]4CNC[C@H]4C3)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C19H28N4O3S.2ClH/c1-15-3-2-4-18(9-15)21-5-7-23(8-6-21)27(25,26)14-19(24)22-12-16-10-20-11-17(16)13-22;;/h2-4,9,16-17,20H,5-8,10-14H2,1H3;2*1H/t16-,17+;; |
| InChIKey | ZTXBYPQBSFVIKH-VWDRLOGHSA-N |
| XLogP | 0.97 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |