C19H30N4O3S — CID 119533705
2-[4-(3-methylphenyl)piperazin-1-yl]sulfonyl-N-(2-pyrrolidin-3-ylethyl)acetamide (PubChem CID 119533705) has the molecular formula C19H30N4O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is 2-[4-(3-methylphenyl)piperazin-1-yl]sulfonyl-N-(2-pyrrolidin-3-ylethyl)acetamide.
| Compound Name | 2-[4-(3-methylphenyl)piperazin-1-yl]sulfonyl-N-(2-pyrrolidin-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 119533705 |
| Molecular Formula | C19H30N4O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-[4-(3-methylphenyl)piperazin-1-yl]sulfonyl-N-(2-pyrrolidin-3-ylethyl)acetamide |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)CC(=O)NCCC3CCNC3)CC2)c1 |
| InChI | InChI=1S/C19H30N4O3S/c1-16-3-2-4-18(13-16)22-9-11-23(12-10-22)27(25,26)15-19(24)21-8-6-17-5-7-20-14-17/h2-4,13,17,20H,5-12,14-15H2,1H3,(H,21,24) |
| InChIKey | YSFNRJPVRHURON-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |