C20H27N5O3S — CID 166419172
N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylacetamide (PubChem CID 166419172) has the molecular formula C20H27N5O3S and a molecular weight of 417.54 g/mol. Its IUPAC name is N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylacetamide.
| Compound Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylacetamide |
|---|---|
| PubChem CID | 166419172 |
| Molecular Formula | C20H27N5O3S |
| Molecular Weight | 417.54 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[2-(3-but-3-ynyldiazirin-3-yl)ethyl]-2-[4-(3-methylphenyl)piperazin-1-yl]sulfonylacetamide |
| SMILES | C#CCCC1(CCNC(=O)CS(=O)(=O)N2CCN(c3cccc(C)c3)CC2)N=N1 |
| InChI | InChI=1S/C20H27N5O3S/c1-3-4-8-20(22-23-20)9-10-21-19(26)16-29(27,28)25-13-11-24(12-14-25)18-7-5-6-17(2)15-18/h1,5-7,15H,4,8-14,16H2,2H3,(H,21,26) |
| InChIKey | CMASYUGTYVYFMH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|