C23H31N3O3S2 — CID 42175839
2-benzylsulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]acetamide (PubChem CID 42175839) has the molecular formula C23H31N3O3S2 and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]acetamide |
|---|---|
| PubChem CID | 42175839 |
| Molecular Formula | C23H31N3O3S2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-benzylsulfanyl-N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]acetamide |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)CCCNC(=O)CSCc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C23H31N3O3S2/c1-20-7-5-10-22(17-20)25-12-14-26(15-13-25)31(28,29)16-6-11-24-23(27)19-30-18-21-8-3-2-4-9-21/h2-5,7-10,17H,6,11-16,18-19H2,1H3,(H,24,27) |
| InChIKey | ZZUXWEROGOMMGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|