C19H25N3O3S2 — CID 42175855
N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]thiophene-2-carboxamide (PubChem CID 42175855) has the molecular formula C19H25N3O3S2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 42175855 |
| Molecular Formula | C19H25N3O3S2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylpropyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc(N2CCN(S(=O)(=O)CCCNC(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C19H25N3O3S2/c1-16-5-2-6-17(15-16)21-9-11-22(12-10-21)27(24,25)14-4-8-20-19(23)18-7-3-13-26-18/h2-3,5-7,13,15H,4,8-12,14H2,1H3,(H,20,23) |
| InChIKey | YTOKICJSKJSFRZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|