C20H27N3O3S2 — CID 53076901
N-butyl-3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide (PubChem CID 53076901) has the molecular formula C20H27N3O3S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-butyl-3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide.
| Compound Name | N-butyl-3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 53076901 |
| Molecular Formula | C20H27N3O3S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-butyl-3-[4-(3-methylphenyl)piperazin-1-yl]sulfonylthiophene-2-carboxamide |
| SMILES | CCCCNC(=O)c1sccc1S(=O)(=O)N1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C20H27N3O3S2/c1-3-4-9-21-20(24)19-18(8-14-27-19)28(25,26)23-12-10-22(11-13-23)17-7-5-6-16(2)15-17/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,21,24) |
| InChIKey | CDLSWNNWJDWBPI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|