C22H22ClN3O3S2 — CID 53076938
3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-N-(3-methylphenyl)thiophene-2-carboxamide (PubChem CID 53076938) has the molecular formula C22H22ClN3O3S2 and a molecular weight of 476.02 g/mol. Its IUPAC name is 3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-N-(3-methylphenyl)thiophene-2-carboxamide.
| Compound Name | 3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-N-(3-methylphenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 53076938 |
| Molecular Formula | C22H22ClN3O3S2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | 3-[4-(2-chlorophenyl)piperazin-1-yl]sulfonyl-N-(3-methylphenyl)thiophene-2-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2sccc2S(=O)(=O)N2CCN(c3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C22H22ClN3O3S2/c1-16-5-4-6-17(15-16)24-22(27)21-20(9-14-30-21)31(28,29)26-12-10-25(11-13-26)19-8-3-2-7-18(19)23/h2-9,14-15H,10-13H2,1H3,(H,24,27) |
| InChIKey | PKCXHDJHOLIXQB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |