C21H24F3N3O3S — CID 41349576
3-methyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]benzamide (PubChem CID 41349576) has the molecular formula C21H24F3N3O3S and a molecular weight of 455.50 g/mol. Its IUPAC name is 3-methyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]benzamide.
| Compound Name | 3-methyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]benzamide |
|---|---|
| PubChem CID | 41349576 |
| Molecular Formula | C21H24F3N3O3S |
| Molecular Weight | 455.50 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-methyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]benzamide |
| SMILES | Cc1cccc(C(=O)NCCS(=O)(=O)N2CCN(c3cccc(C(F)(F)F)c3)CC2)c1 |
| InChI | InChI=1S/C21H24F3N3O3S/c1-16-4-2-5-17(14-16)20(28)25-8-13-31(29,30)27-11-9-26(10-12-27)19-7-3-6-18(15-19)21(22,23)24/h2-7,14-15H,8-13H2,1H3,(H,25,28) |
| InChIKey | NRKHYDJYLHVFDN-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |