C23H28F3N3O3S — CID 41349663
4-phenyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]butanamide (PubChem CID 41349663) has the molecular formula C23H28F3N3O3S and a molecular weight of 483.56 g/mol. Its IUPAC name is 4-phenyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]butanamide.
| Compound Name | 4-phenyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]butanamide |
|---|---|
| PubChem CID | 41349663 |
| Molecular Formula | C23H28F3N3O3S |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-phenyl-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]butanamide |
| SMILES | O=C(CCCc1ccccc1)NCCS(=O)(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C23H28F3N3O3S/c24-23(25,26)20-9-5-10-21(18-20)28-13-15-29(16-14-28)33(31,32)17-12-27-22(30)11-4-8-19-6-2-1-3-7-19/h1-3,5-7,9-10,18H,4,8,11-17H2,(H,27,30) |
| InChIKey | XMMVXUCSJBRRPW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |