C22H25F3N2O3S — CID 55687956
2-(3-phenylpropylsulfonyl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone (PubChem CID 55687956) has the molecular formula C22H25F3N2O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is 2-(3-phenylpropylsulfonyl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(3-phenylpropylsulfonyl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55687956 |
| Molecular Formula | C22H25F3N2O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-(3-phenylpropylsulfonyl)-1-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CS(=O)(=O)CCCc1ccccc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H25F3N2O3S/c23-22(24,25)19-9-4-10-20(16-19)26-11-13-27(14-12-26)21(28)17-31(29,30)15-5-8-18-6-2-1-3-7-18/h1-4,6-7,9-10,16H,5,8,11-15,17H2 |
| InChIKey | TYDMHXDQAKGYSW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |