C23H22F3N3O5S — CID 41349669
2-oxo-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]chromene-3-carboxamide (PubChem CID 41349669) has the molecular formula C23H22F3N3O5S and a molecular weight of 509.51 g/mol. Its IUPAC name is 2-oxo-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 41349669 |
| Molecular Formula | C23H22F3N3O5S |
| Molecular Weight | 509.51 g/mol |
| Exact Mass | 509.12 |
| IUPAC Name | 2-oxo-N-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonylethyl]chromene-3-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(c2cccc(C(F)(F)F)c2)CC1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C23H22F3N3O5S/c24-23(25,26)17-5-3-6-18(15-17)28-9-11-29(12-10-28)35(32,33)13-8-27-21(30)19-14-16-4-1-2-7-20(16)34-22(19)31/h1-7,14-15H,8-13H2,(H,27,30) |
| InChIKey | IMAXVLMPQDQZBQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.51 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|