C19H21N5O4S — CID 25285444
N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylethyl]-1-benzofuran-2-carboxamide (PubChem CID 25285444) has the molecular formula C19H21N5O4S and a molecular weight of 415.48 g/mol. Its IUPAC name is N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylethyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 25285444 |
| Molecular Formula | C19H21N5O4S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)sulfonylethyl]-1-benzofuran-2-carboxamide |
| SMILES | O=C(NCCS(=O)(=O)N1CCN(c2ncccn2)CC1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H21N5O4S/c25-18(17-14-15-4-1-2-5-16(15)28-17)20-8-13-29(26,27)24-11-9-23(10-12-24)19-21-6-3-7-22-19/h1-7,14H,8-13H2,(H,20,25) |
| InChIKey | ABHRZQUEFRKHMX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |