C22H26N4O2 — CID 175643050
3-[[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-methylquinolin-2-one (PubChem CID 175643050) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-[[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-methylquinolin-2-one.
| Compound Name | 3-[[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 175643050 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-[[(3aR,5R,6R,7aS)-5-hydroxy-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-1-methylquinolin-2-one |
| SMILES | Cn1c(=O)c(CN2C[C@H]3C[C@@H](n4cccn4)[C@H](O)C[C@H]3C2)cc2ccccc21 |
| InChI | InChI=1S/C22H26N4O2/c1-24-19-6-3-2-5-15(19)9-18(22(24)28)14-25-12-16-10-20(26-8-4-7-23-26)21(27)11-17(16)13-25/h2-9,16-17,20-21,27H,10-14H2,1H3/t16-,17+,20-,21-/m1/s1 |
| InChIKey | JHRYXGPTYMJUJA-HRQSHJORSA-N |
| XLogP | 2.18 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |