C21H29N3O3S — CID 172672254
(3aR,5R,6R,7aS)-2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172672254) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172672254 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | COc1cc(SC)c(OC)cc1CN1C[C@H]2C[C@@H](n3cccn3)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C21H29N3O3S/c1-26-19-10-21(28-3)20(27-2)9-16(19)13-23-11-14-7-17(24-6-4-5-22-24)18(25)8-15(14)12-23/h4-6,9-10,14-15,17-18,25H,7-8,11-13H2,1-3H3/t14-,15+,17-,18-/m1/s1 |
| InChIKey | FDEPZPWMCVFWAT-CYGHRXIMSA-N |
| XLogP | 3.07 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |