C20H32N2O3S — CID 155913642
(4S,9aR)-8-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 155913642) has the molecular formula C20H32N2O3S and a molecular weight of 380.55 g/mol. Its IUPAC name is (4S,9aR)-8-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-8-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 155913642 |
| Molecular Formula | C20H32N2O3S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (4S,9aR)-8-[(2,5-dimethoxy-4-methylsulfanylphenyl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | CCC[C@H]1COC[C@H]2CN(Cc3cc(OC)c(SC)cc3OC)CCN12 |
| InChI | InChI=1S/C20H32N2O3S/c1-5-6-16-13-25-14-17-12-21(7-8-22(16)17)11-15-9-19(24-3)20(26-4)10-18(15)23-2/h9-10,16-17H,5-8,11-14H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | MLTIHPYKYMXOKH-DLBZAZTESA-N |
| XLogP | 3.11 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |