C15H25N3OS — CID 134713615
(4S,9aR)-8-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine (PubChem CID 134713615) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is (4S,9aR)-8-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine.
| Compound Name | (4S,9aR)-8-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 134713615 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | (4S,9aR)-8-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine |
| SMILES | CCC[C@H]1COC[C@H]2CN(Cc3scnc3C)CCN12 |
| InChI | InChI=1S/C15H25N3OS/c1-3-4-13-9-19-10-14-7-17(5-6-18(13)14)8-15-12(2)16-11-20-15/h11,13-14H,3-10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | CNWRVPPJTDNLIV-UONOGXRCSA-N |
| XLogP | 2.14 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |