C18H23N3O2S — CID 134706093
[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(1,3-benzothiazol-5-yl)methanone (PubChem CID 134706093) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is [(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(1,3-benzothiazol-5-yl)methanone.
| Compound Name | [(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(1,3-benzothiazol-5-yl)methanone |
|---|---|
| PubChem CID | 134706093 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | [(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(1,3-benzothiazol-5-yl)methanone |
| SMILES | CCC[C@H]1COC[C@H]2CN(C(=O)c3ccc4scnc4c3)CCN12 |
| InChI | InChI=1S/C18H23N3O2S/c1-2-3-14-10-23-11-15-9-20(6-7-21(14)15)18(22)13-4-5-17-16(8-13)19-12-24-17/h4-5,8,12,14-15H,2-3,6-7,9-11H2,1H3/t14-,15+/m0/s1 |
| InChIKey | FAIZDMAPRPXGPP-LSDHHAIUSA-N |
| XLogP | 2.62 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |