C17H20N4O2 — CID 155499880
[(4S,9aR)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-quinoxalin-6-ylmethanone (PubChem CID 155499880) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is [(4S,9aR)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-quinoxalin-6-ylmethanone.
| Compound Name | [(4S,9aR)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-quinoxalin-6-ylmethanone |
|---|---|
| PubChem CID | 155499880 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | [(4S,9aR)-4-methyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-quinoxalin-6-ylmethanone |
| SMILES | C[C@H]1COC[C@H]2CN(C(=O)c3ccc4nccnc4c3)CCN21 |
| InChI | InChI=1S/C17H20N4O2/c1-12-10-23-11-14-9-20(6-7-21(12)14)17(22)13-2-3-15-16(8-13)19-5-4-18-15/h2-5,8,12,14H,6-7,9-11H2,1H3/t12-,14+/m0/s1 |
| InChIKey | CPRZBDMGEDVHNZ-GXTWGEPZSA-N |
| XLogP | 1.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |