C20H25N3O3 — CID 134702252
[(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-phenyl-1,2-oxazol-4-yl)methanone (PubChem CID 134702252) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-phenyl-1,2-oxazol-4-yl)methanone.
| Compound Name | [(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-phenyl-1,2-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 134702252 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(4S,9aR)-4-propyl-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-(5-phenyl-1,2-oxazol-4-yl)methanone |
| SMILES | CCC[C@H]1COC[C@H]2CN(C(=O)c3cnoc3-c3ccccc3)CCN12 |
| InChI | InChI=1S/C20H25N3O3/c1-2-6-16-13-25-14-17-12-22(9-10-23(16)17)20(24)18-11-21-26-19(18)15-7-4-3-5-8-15/h3-5,7-8,11,16-17H,2,6,9-10,12-14H2,1H3/t16-,17+/m0/s1 |
| InChIKey | UDDGYFONEFGXIP-DLBZAZTESA-N |
| XLogP | 2.67 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |