C21H30N4O2 — CID 172673912
(3aR,5R,6R,7aS)-2-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172673912) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172673912 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(3-cyclohexyl-1,2-oxazol-5-yl)methyl]-6-pyrazol-1-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | O[C@@H]1C[C@H]2CN(Cc3cc(C4CCCCC4)no3)C[C@H]2C[C@H]1n1cccn1 |
| InChI | InChI=1S/C21H30N4O2/c26-21-10-17-13-24(12-16(17)9-20(21)25-8-4-7-22-25)14-18-11-19(23-27-18)15-5-2-1-3-6-15/h4,7-8,11,15-17,20-21,26H,1-3,5-6,9-10,12-14H2/t16-,17+,20-,21-/m1/s1 |
| InChIKey | YFPLBUKYHDAXNC-HRQSHJORSA-N |
| XLogP | 3.36 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |