C15H25N5O — CID 100836465
1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 100836465) has the molecular formula C15H25N5O and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 100836465 |
| Molecular Formula | C15H25N5O |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 1-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-[2-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | Cn1cc(CCNC(=O)N[C@H]2CCN3CCCC[C@@H]23)cn1 |
| InChI | InChI=1S/C15H25N5O/c1-19-11-12(10-17-19)5-7-16-15(21)18-13-6-9-20-8-3-2-4-14(13)20/h10-11,13-14H,2-9H2,1H3,(H2,16,18,21)/t13-,14-/m0/s1 |
| InChIKey | FUKIVJOHMLMBHJ-KBPBESRZSA-N |
| XLogP | 0.89 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |