C20H20F3N3O3 — CID 55836314
1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea (PubChem CID 55836314) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea.
| Compound Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 55836314 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-fluorophenyl]-3-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(C(=O)N2CCCC2)c1)Nc1ccc(OC(F)F)c(F)c1 |
| InChI | InChI=1S/C20H20F3N3O3/c21-16-11-15(6-7-17(16)29-19(22)23)25-20(28)24-12-13-4-3-5-14(10-13)18(27)26-8-1-2-9-26/h3-7,10-11,19H,1-2,8-9,12H2,(H2,24,25,28) |
| InChIKey | DXDZCNIWKZYHNR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |