C22H27N3O5 — CID 55701806
1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 55701806) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 55701806 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 1-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCc2cccc(C(=O)N3CCCC3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N3O5/c1-28-18-12-17(13-19(29-2)20(18)30-3)24-22(27)23-14-15-7-6-8-16(11-15)21(26)25-9-4-5-10-25/h6-8,11-13H,4-5,9-10,14H2,1-3H3,(H2,23,24,27) |
| InChIKey | JIENDCFBDFQKPQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |