C21H25N3O5 — CID 53089926
1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 53089926) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is 1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 53089926 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NCc2ccc3c(c2)CCN3C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H25N3O5/c1-13(25)24-8-7-15-9-14(5-6-17(15)24)12-22-21(26)23-16-10-18(27-2)20(29-4)19(11-16)28-3/h5-6,9-11H,7-8,12H2,1-4H3,(H2,22,23,26) |
| InChIKey | MXPYCAVVWLSIHW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |