C20H23N3O4 — CID 53089931
1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(2,4-dimethoxyphenyl)urea (PubChem CID 53089931) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(2,4-dimethoxyphenyl)urea.
| Compound Name | 1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 53089931 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[(1-acetyl-2,3-dihydroindol-5-yl)methyl]-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCc2ccc3c(c2)CCN3C(C)=O)c(OC)c1 |
| InChI | InChI=1S/C20H23N3O4/c1-13(24)23-9-8-15-10-14(4-7-18(15)23)12-21-20(25)22-17-6-5-16(26-2)11-19(17)27-3/h4-7,10-11H,8-9,12H2,1-3H3,(H2,21,22,25) |
| InChIKey | CQWLEJQJHFJSGB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |