C22H26N2O2S — CID 47057188
4-propan-2-ylsulfanyl-N-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide (PubChem CID 47057188) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 4-propan-2-ylsulfanyl-N-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide.
| Compound Name | 4-propan-2-ylsulfanyl-N-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 47057188 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 4-propan-2-ylsulfanyl-N-[[3-(pyrrolidine-1-carbonyl)phenyl]methyl]benzamide |
| SMILES | CC(C)Sc1ccc(C(=O)NCc2cccc(C(=O)N3CCCC3)c2)cc1 |
| InChI | InChI=1S/C22H26N2O2S/c1-16(2)27-20-10-8-18(9-11-20)21(25)23-15-17-6-5-7-19(14-17)22(26)24-12-3-4-13-24/h5-11,14,16H,3-4,12-13,15H2,1-2H3,(H,23,25) |
| InChIKey | FUOJOGOFFIZAGY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |