C15H18ClN3O — CID 166262127
6-chloro-N-[(3-methylpyrrolidin-2-yl)methyl]-1H-indole-2-carboxamide (PubChem CID 166262127) has the molecular formula C15H18ClN3O and a molecular weight of 291.78 g/mol. Its IUPAC name is 6-chloro-N-[(3-methylpyrrolidin-2-yl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[(3-methylpyrrolidin-2-yl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166262127 |
| Molecular Formula | C15H18ClN3O |
| Molecular Weight | 291.78 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 6-chloro-N-[(3-methylpyrrolidin-2-yl)methyl]-1H-indole-2-carboxamide |
| SMILES | CC1CCNC1CNC(=O)c1cc2ccc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C15H18ClN3O/c1-9-4-5-17-14(9)8-18-15(20)13-6-10-2-3-11(16)7-12(10)19-13/h2-3,6-7,9,14,17,19H,4-5,8H2,1H3,(H,18,20) |
| InChIKey | BHRTWJCXAHKDKZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.78 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |