C18H18ClN5O2 — CID 70216318
6-[(3-aminophenyl)methoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (PubChem CID 70216318) has the molecular formula C18H18ClN5O2 and a molecular weight of 371.83 g/mol. Its IUPAC name is 6-[(3-aminophenyl)methoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
| Compound Name | 6-[(3-aminophenyl)methoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70216318 |
| Molecular Formula | C18H18ClN5O2 |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 6-[(3-aminophenyl)methoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(Cl)cc(OCc3cccc(N)c3)cc2[nH]1 |
| InChI | InChI=1S/C18H18ClN5O2/c1-22-18(21)24-17(25)16-8-13-14(19)6-12(7-15(13)23-16)26-9-10-3-2-4-11(20)5-10/h2-8,23H,9,20H2,1H3,(H3,21,22,24,25) |
| InChIKey | PTMGCKSWCJGTPV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|