C21H25Cl2N5O2 — CID 67645541
7-[2-[benzyl(methyl)amino]ethoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride (PubChem CID 67645541) has the molecular formula C21H25Cl2N5O2 and a molecular weight of 450.37 g/mol. Its IUPAC name is 7-[2-[benzyl(methyl)amino]ethoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | 7-[2-[benzyl(methyl)amino]ethoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67645541 |
| Molecular Formula | C21H25Cl2N5O2 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 7-[2-[benzyl(methyl)amino]ethoxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide;hydrochloride |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(Cl)ccc(OCCN(C)Cc3ccccc3)c2[nH]1.Cl |
| InChI | InChI=1S/C21H24ClN5O2.ClH/c1-24-21(23)26-20(28)17-12-15-16(22)8-9-18(19(15)25-17)29-11-10-27(2)13-14-6-4-3-5-7-14;/h3-9,12,25H,10-11,13H2,1-2H3,(H3,23,24,26,28);1H |
| InChIKey | BXWHSBYTKNXVHW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|