C21H22F3N5O2 — CID 70215115
7-[4-[(dimethylamino)methyl]phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 70215115) has the molecular formula C21H22F3N5O2 and a molecular weight of 433.43 g/mol. Its IUPAC name is 7-[4-[(dimethylamino)methyl]phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | 7-[4-[(dimethylamino)methyl]phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70215115 |
| Molecular Formula | C21H22F3N5O2 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 7-[4-[(dimethylamino)methyl]phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(C(F)(F)F)ccc(Oc3ccc(CN(C)C)cc3)c2[nH]1 |
| InChI | InChI=1S/C21H22F3N5O2/c1-26-20(25)28-19(30)16-10-14-15(21(22,23)24)8-9-17(18(14)27-16)31-13-6-4-12(5-7-13)11-29(2)3/h4-10,27H,11H2,1-3H3,(H3,25,26,28,30) |
| InChIKey | VEZFDQUPMOTKEV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|