C23H24F3N5O2 — CID 70215032
N-(N'-methylcarbamimidoyl)-7-[2-(pyrrolidin-1-ylmethyl)phenoxy]-4-(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 70215032) has the molecular formula C23H24F3N5O2 and a molecular weight of 459.47 g/mol. Its IUPAC name is N-(N'-methylcarbamimidoyl)-7-[2-(pyrrolidin-1-ylmethyl)phenoxy]-4-(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | N-(N'-methylcarbamimidoyl)-7-[2-(pyrrolidin-1-ylmethyl)phenoxy]-4-(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70215032 |
| Molecular Formula | C23H24F3N5O2 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-(N'-methylcarbamimidoyl)-7-[2-(pyrrolidin-1-ylmethyl)phenoxy]-4-(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(C(F)(F)F)ccc(Oc3ccccc3CN3CCCC3)c2[nH]1 |
| InChI | InChI=1S/C23H24F3N5O2/c1-28-22(27)30-21(32)17-12-15-16(23(24,25)26)8-9-19(20(15)29-17)33-18-7-3-2-6-14(18)13-31-10-4-5-11-31/h2-3,6-9,12,29H,4-5,10-11,13H2,1H3,(H3,27,28,30,32) |
| InChIKey | KOYJQGZSGMGJAV-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|