C17H15F3N6O2 — CID 70216378
6-[(2-amino-4-pyridinyl)oxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 70216378) has the molecular formula C17H15F3N6O2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 6-[(2-amino-4-pyridinyl)oxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | 6-[(2-amino-4-pyridinyl)oxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70216378 |
| Molecular Formula | C17H15F3N6O2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 6-[(2-amino-4-pyridinyl)oxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(C(F)(F)F)cc(Oc3ccnc(N)c3)cc2[nH]1 |
| InChI | InChI=1S/C17H15F3N6O2/c1-23-16(22)26-15(27)13-7-10-11(17(18,19)20)4-9(5-12(10)25-13)28-8-2-3-24-14(21)6-8/h2-7,25H,1H3,(H2,21,24)(H3,22,23,26,27) |
| InChIKey | HEQNMTMCQVIDBE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|