C16H15ClN6O2 — CID 70215071
6-[(2-amino-4-pyridinyl)oxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (PubChem CID 70215071) has the molecular formula C16H15ClN6O2 and a molecular weight of 358.79 g/mol. Its IUPAC name is 6-[(2-amino-4-pyridinyl)oxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
| Compound Name | 6-[(2-amino-4-pyridinyl)oxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70215071 |
| Molecular Formula | C16H15ClN6O2 |
| Molecular Weight | 358.79 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 6-[(2-amino-4-pyridinyl)oxy]-4-chloro-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(Cl)cc(Oc3ccnc(N)c3)cc2[nH]1 |
| InChI | InChI=1S/C16H15ClN6O2/c1-20-16(19)23-15(24)13-7-10-11(17)4-9(5-12(10)22-13)25-8-2-3-21-14(18)6-8/h2-7,22H,1H3,(H2,18,21)(H3,19,20,23,24) |
| InChIKey | ORWIOXQOPYCGMH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.79 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|