C19H18F3N5O2 — CID 70218110
6-[2-(aminomethyl)phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 70218110) has the molecular formula C19H18F3N5O2 and a molecular weight of 405.38 g/mol. Its IUPAC name is 6-[2-(aminomethyl)phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | 6-[2-(aminomethyl)phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70218110 |
| Molecular Formula | C19H18F3N5O2 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 6-[2-(aminomethyl)phenoxy]-N-(N'-methylcarbamimidoyl)-4-(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(C(F)(F)F)cc(Oc3ccccc3CN)cc2[nH]1 |
| InChI | InChI=1S/C19H18F3N5O2/c1-25-18(24)27-17(28)15-8-12-13(19(20,21)22)6-11(7-14(12)26-15)29-16-5-3-2-4-10(16)9-23/h2-8,26H,9,23H2,1H3,(H3,24,25,27,28) |
| InChIKey | JQWFFGRAQDOYAF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|