C21H24ClN5O2 — CID 70213801
4-chloro-6-[[2-[(dimethylamino)methyl]phenyl]methoxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (PubChem CID 70213801) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 4-chloro-6-[[2-[(dimethylamino)methyl]phenyl]methoxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
| Compound Name | 4-chloro-6-[[2-[(dimethylamino)methyl]phenyl]methoxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70213801 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 4-chloro-6-[[2-[(dimethylamino)methyl]phenyl]methoxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2c(Cl)cc(OCc3ccccc3CN(C)C)cc2[nH]1 |
| InChI | InChI=1S/C21H24ClN5O2/c1-24-21(23)26-20(28)19-10-16-17(22)8-15(9-18(16)25-19)29-12-14-7-5-4-6-13(14)11-27(2)3/h4-10,25H,11-12H2,1-3H3,(H3,23,24,26,28) |
| InChIKey | SOHUSBWYMIATPE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|