C17H18N6O2 — CID 139697400
6-[[5-(aminomethyl)-3-pyridinyl]oxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide (PubChem CID 139697400) has the molecular formula C17H18N6O2 and a molecular weight of 338.37 g/mol. Its IUPAC name is 6-[[5-(aminomethyl)-3-pyridinyl]oxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide.
| Compound Name | 6-[[5-(aminomethyl)-3-pyridinyl]oxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 139697400 |
| Molecular Formula | C17H18N6O2 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 6-[[5-(aminomethyl)-3-pyridinyl]oxy]-N-(N'-methylcarbamimidoyl)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2ccc(Oc3cncc(CN)c3)cc2[nH]1 |
| InChI | InChI=1S/C17H18N6O2/c1-20-17(19)23-16(24)15-5-11-2-3-12(6-14(11)22-15)25-13-4-10(7-18)8-21-9-13/h2-6,8-9,22H,7,18H2,1H3,(H3,19,20,23,24) |
| InChIKey | PUAZMRGHSSLBMS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|