About N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide
N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide (PubChem CID 70218200) has the molecular formula C17H15N5O4
and a molecular weight of 353.34 g/mol. Its IUPAC name is N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide |
| PubChem CID | 70218200 |
| Molecular Formula | C17H15N5O4 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2ccc(Oc3ccccc3[N+](=O)[O-])cc2[nH]1 |
| InChI | InChI=1S/C17H15N5O4/c1-19-17(18)21-16(23)13-8-10-6-7-11(9-12(10)20-13)26-15-5-3-2-4-14(15)22(24)25/h2-9,20H,1H3,(H3,18,19,21,23) |
| InChIKey | QIMAXEVKPCOVRL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide?
The IUPAC name of N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide (CID 70218200) is N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide.
What is the SMILES notation for N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide?
The canonical SMILES for N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide is C/N=C(\N)NC(=O)c1cc2ccc(Oc3ccccc3[N+](=O)[O-])cc2[nH]1.
What is the InChIKey of N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide?
The InChIKey is QIMAXEVKPCOVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5O4/c1-19-17(18)21-16(23)13-8-10-6-7-11(9-12(10)20-13)26-15-5-3-2-4-14(15)22(24)25/h2-9,20H,1H3,(H3,18,19,21,23).
What are the key properties of N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide?
N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide has a molecular weight of 353.34 g/mol, XLogP of 2.54, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(N'-methylcarbamimidoyl)-6-(2-nitrophenoxy)-1H-indole-2-carboxamide is sourced from PubChem (CID 70218200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).