C20H23N5O3 — CID 139697399
N-(N'-methylcarbamimidoyl)-7-[5-(pyrrolidin-1-ylmethyl)furan-2-yl]oxy-1H-indole-2-carboxamide (PubChem CID 139697399) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(N'-methylcarbamimidoyl)-7-[5-(pyrrolidin-1-ylmethyl)furan-2-yl]oxy-1H-indole-2-carboxamide.
| Compound Name | N-(N'-methylcarbamimidoyl)-7-[5-(pyrrolidin-1-ylmethyl)furan-2-yl]oxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 139697399 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-(N'-methylcarbamimidoyl)-7-[5-(pyrrolidin-1-ylmethyl)furan-2-yl]oxy-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2cccc(Oc3ccc(CN4CCCC4)o3)c2[nH]1 |
| InChI | InChI=1S/C20H23N5O3/c1-22-20(21)24-19(26)15-11-13-5-4-6-16(18(13)23-15)28-17-8-7-14(27-17)12-25-9-2-3-10-25/h4-8,11,23H,2-3,9-10,12H2,1H3,(H3,21,22,24,26) |
| InChIKey | KKNXYHJOIDZZGI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|