C19H23NO7 — CID 126460371
2-hydroxypropanedioic acid;1-[(5-phenoxyfuran-2-yl)methyl]piperidine (PubChem CID 126460371) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-hydroxypropanedioic acid;1-[(5-phenoxyfuran-2-yl)methyl]piperidine.
| Compound Name | 2-hydroxypropanedioic acid;1-[(5-phenoxyfuran-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 126460371 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-hydroxypropanedioic acid;1-[(5-phenoxyfuran-2-yl)methyl]piperidine |
| SMILES | O=C(O)C(O)C(=O)O.c1ccc(Oc2ccc(CN3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C16H19NO2.C3H4O5/c1-3-7-14(8-4-1)18-16-10-9-15(19-16)13-17-11-5-2-6-12-17;4-1(2(5)6)3(7)8/h1,3-4,7-10H,2,5-6,11-13H2;1,4H,(H,5,6)(H,7,8) |
| InChIKey | MCFZDVXVWPSJFX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 120.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|