C23H27N5O2 — CID 70214887
N-(N'-methylcarbamimidoyl)-7-[4-(piperidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide (PubChem CID 70214887) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-(N'-methylcarbamimidoyl)-7-[4-(piperidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide.
| Compound Name | N-(N'-methylcarbamimidoyl)-7-[4-(piperidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70214887 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-(N'-methylcarbamimidoyl)-7-[4-(piperidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide |
| SMILES | C/N=C(\N)NC(=O)c1cc2cccc(Oc3ccc(CN4CCCCC4)cc3)c2[nH]1 |
| InChI | InChI=1S/C23H27N5O2/c1-25-23(24)27-22(29)19-14-17-6-5-7-20(21(17)26-19)30-18-10-8-16(9-11-18)15-28-12-3-2-4-13-28/h5-11,14,26H,2-4,12-13,15H2,1H3,(H3,24,25,27,29) |
| InChIKey | ZUHXZCZPZLVBQI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|