C16H21ClF3N5O — CID 142650473
N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-(trifluoromethyl)-1H-indole-2-carboxamide;hydrochloride (PubChem CID 142650473) has the molecular formula C16H21ClF3N5O and a molecular weight of 391.83 g/mol. Its IUPAC name is N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-(trifluoromethyl)-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-(trifluoromethyl)-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142650473 |
| Molecular Formula | C16H21ClF3N5O |
| Molecular Weight | 391.83 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-[N'-[3-(dimethylamino)propyl]carbamimidoyl]-4-(trifluoromethyl)-1H-indole-2-carboxamide;hydrochloride |
| SMILES | CN(C)CCC/N=C(\N)NC(=O)c1cc2c(C(F)(F)F)cccc2[nH]1.Cl |
| InChI | InChI=1S/C16H20F3N5O.ClH/c1-24(2)8-4-7-21-15(20)23-14(25)13-9-10-11(16(17,18)19)5-3-6-12(10)22-13;/h3,5-6,9,22H,4,7-8H2,1-2H3,(H3,20,21,23,25);1H |
| InChIKey | BZVDIOQBAYWBMU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.83 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|