C14H18Cl2N4O3 — CID 70213588
N-carbamimidoyl-4-chloro-7-(3-hydroxypropoxy)-N-methyl-1H-indole-2-carboxamide;hydrochloride (PubChem CID 70213588) has the molecular formula C14H18Cl2N4O3 and a molecular weight of 361.23 g/mol. Its IUPAC name is N-carbamimidoyl-4-chloro-7-(3-hydroxypropoxy)-N-methyl-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-carbamimidoyl-4-chloro-7-(3-hydroxypropoxy)-N-methyl-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70213588 |
| Molecular Formula | C14H18Cl2N4O3 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-carbamimidoyl-4-chloro-7-(3-hydroxypropoxy)-N-methyl-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N(C)C(=O)c1cc2c(Cl)ccc(OCCCO)c2[nH]1 |
| InChI | InChI=1S/C14H17ClN4O3.ClH/c1-19(14(16)17)13(21)10-7-8-9(15)3-4-11(12(8)18-10)22-6-2-5-20;/h3-4,7,18,20H,2,5-6H2,1H3,(H3,16,17);1H |
| InChIKey | ZRXIAOSAPOXNBI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|