C20H22F3N5O3 — CID 70216839
N-carbamimidoyl-7-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-N-methyl-4-(trifluoromethyl)-1H-indole-2-carboxamide (PubChem CID 70216839) has the molecular formula C20H22F3N5O3 and a molecular weight of 437.42 g/mol. Its IUPAC name is N-carbamimidoyl-7-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-N-methyl-4-(trifluoromethyl)-1H-indole-2-carboxamide.
| Compound Name | N-carbamimidoyl-7-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-N-methyl-4-(trifluoromethyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 70216839 |
| Molecular Formula | C20H22F3N5O3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | N-carbamimidoyl-7-[[5-[(dimethylamino)methyl]furan-2-yl]methoxy]-N-methyl-4-(trifluoromethyl)-1H-indole-2-carboxamide |
| SMILES | [H]/N=C(\N)N(C)C(=O)c1cc2c(C(F)(F)F)ccc(OCc3ccc(CN(C)C)o3)c2[nH]1 |
| InChI | InChI=1S/C20H22F3N5O3/c1-27(2)9-11-4-5-12(31-11)10-30-16-7-6-14(20(21,22)23)13-8-15(26-17(13)16)18(29)28(3)19(24)25/h4-8,26H,9-10H2,1-3H3,(H3,24,25) |
| InChIKey | STODRBLTPMFHHN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|