C21H25N5O2 — CID 54405043
N-carbamimidoyl-7-[[3-[(dimethylamino)methyl]phenyl]methoxy]-N-methyl-1H-indole-2-carboxamide (PubChem CID 54405043) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-carbamimidoyl-7-[[3-[(dimethylamino)methyl]phenyl]methoxy]-N-methyl-1H-indole-2-carboxamide.
| Compound Name | N-carbamimidoyl-7-[[3-[(dimethylamino)methyl]phenyl]methoxy]-N-methyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 54405043 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-carbamimidoyl-7-[[3-[(dimethylamino)methyl]phenyl]methoxy]-N-methyl-1H-indole-2-carboxamide |
| SMILES | [H]/N=C(\N)N(C)C(=O)c1cc2cccc(OCc3cccc(CN(C)C)c3)c2[nH]1 |
| InChI | InChI=1S/C21H25N5O2/c1-25(2)12-14-6-4-7-15(10-14)13-28-18-9-5-8-16-11-17(24-19(16)18)20(27)26(3)21(22)23/h4-11,24H,12-13H2,1-3H3,(H3,22,23) |
| InChIKey | VQCCGIKGRUIYLD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|