C20H23ClN4O2 — CID 70213699
N-carbamimidoyl-N-methyl-7-(3-phenylpropoxy)-1H-indole-2-carboxamide;hydrochloride (PubChem CID 70213699) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is N-carbamimidoyl-N-methyl-7-(3-phenylpropoxy)-1H-indole-2-carboxamide;hydrochloride.
| Compound Name | N-carbamimidoyl-N-methyl-7-(3-phenylpropoxy)-1H-indole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 70213699 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-carbamimidoyl-N-methyl-7-(3-phenylpropoxy)-1H-indole-2-carboxamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N(C)C(=O)c1cc2cccc(OCCCc3ccccc3)c2[nH]1 |
| InChI | InChI=1S/C20H22N4O2.ClH/c1-24(20(21)22)19(25)16-13-15-10-5-11-17(18(15)23-16)26-12-6-9-14-7-3-2-4-8-14;/h2-5,7-8,10-11,13,23H,6,9,12H2,1H3,(H3,21,22);1H |
| InChIKey | PPLZUCPADVSJPD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|