C18H27Cl2N5O2 — CID 70213785
N-carbamimidoyl-N,4-dimethyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 70213785) has the molecular formula C18H27Cl2N5O2 and a molecular weight of 416.35 g/mol. Its IUPAC name is N-carbamimidoyl-N,4-dimethyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-carbamimidoyl-N,4-dimethyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70213785 |
| Molecular Formula | C18H27Cl2N5O2 |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-carbamimidoyl-N,4-dimethyl-7-(2-pyrrolidin-1-ylethoxy)-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N(C)C(=O)c1cc2c(C)ccc(OCCN3CCCC3)c2[nH]1 |
| InChI | InChI=1S/C18H25N5O2.2ClH/c1-12-5-6-15(25-10-9-23-7-3-4-8-23)16-13(12)11-14(21-16)17(24)22(2)18(19)20;;/h5-6,11,21H,3-4,7-10H2,1-2H3,(H3,19,20);2*1H |
| InChIKey | DAZDLBQBEVWOCM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|