C22H24ClN5O2 — CID 22370147
N-carbamimidoyl-4-chloro-N-methyl-6-[3-(pyrrolidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide (PubChem CID 22370147) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is N-carbamimidoyl-4-chloro-N-methyl-6-[3-(pyrrolidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide.
| Compound Name | N-carbamimidoyl-4-chloro-N-methyl-6-[3-(pyrrolidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 22370147 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-carbamimidoyl-4-chloro-N-methyl-6-[3-(pyrrolidin-1-ylmethyl)phenoxy]-1H-indole-2-carboxamide |
| SMILES | [H]/N=C(\N)N(C)C(=O)c1cc2c(Cl)cc(Oc3cccc(CN4CCCC4)c3)cc2[nH]1 |
| InChI | InChI=1S/C22H24ClN5O2/c1-27(22(24)25)21(29)20-12-17-18(23)10-16(11-19(17)26-20)30-15-6-4-5-14(9-15)13-28-7-2-3-8-28/h4-6,9-12,26H,2-3,7-8,13H2,1H3,(H3,24,25) |
| InChIKey | IXZWKRALOCGCDB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 98.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|