C15H23Cl2N5O2 — CID 70217829
7-(3-aminopropoxy)-N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 70217829) has the molecular formula C15H23Cl2N5O2 and a molecular weight of 376.29 g/mol. Its IUPAC name is 7-(3-aminopropoxy)-N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | 7-(3-aminopropoxy)-N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70217829 |
| Molecular Formula | C15H23Cl2N5O2 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | 7-(3-aminopropoxy)-N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N(C)C(=O)c1cc2c(C)ccc(OCCCN)c2[nH]1 |
| InChI | InChI=1S/C15H21N5O2.2ClH/c1-9-4-5-12(22-7-3-6-16)13-10(9)8-11(19-13)14(21)20(2)15(17)18;;/h4-5,8,19H,3,6-7,16H2,1-2H3,(H3,17,18);2*1H |
| InChIKey | SYKIWBWQZAFFTH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|