C18H20Cl3N5O2 — CID 70213647
7-[4-(aminomethyl)phenoxy]-N-carbamimidoyl-4-chloro-N-methyl-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 70213647) has the molecular formula C18H20Cl3N5O2 and a molecular weight of 444.75 g/mol. Its IUPAC name is 7-[4-(aminomethyl)phenoxy]-N-carbamimidoyl-4-chloro-N-methyl-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | 7-[4-(aminomethyl)phenoxy]-N-carbamimidoyl-4-chloro-N-methyl-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 70213647 |
| Molecular Formula | C18H20Cl3N5O2 |
| Molecular Weight | 444.75 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 7-[4-(aminomethyl)phenoxy]-N-carbamimidoyl-4-chloro-N-methyl-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N(C)C(=O)c1cc2c(Cl)ccc(Oc3ccc(CN)cc3)c2[nH]1 |
| InChI | InChI=1S/C18H18ClN5O2.2ClH/c1-24(18(21)22)17(25)14-8-12-13(19)6-7-15(16(12)23-14)26-11-4-2-10(9-20)3-5-11;;/h2-8,23H,9,20H2,1H3,(H3,21,22);2*1H |
| InChIKey | MHYGTRPXRAKLGN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.75 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|